C9H11FN2 — CID 89209371
8-fluoro-3,4,7,8-tetrahydroquinolin-6-amine (PubChem CID 89209371) has the molecular formula C9H11FN2 and a molecular weight of 166.20 g/mol. Its IUPAC name is 8-fluoro-3,4,7,8-tetrahydroquinolin-6-amine.
| Compound Name | 8-fluoro-3,4,7,8-tetrahydroquinolin-6-amine |
|---|---|
| PubChem CID | 89209371 |
| Molecular Formula | C9H11FN2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 8-fluoro-3,4,7,8-tetrahydroquinolin-6-amine |
| SMILES | NC1=CC2=C(N=CCC2)C(F)C1 |
| InChI | InChI=1S/C9H11FN2/c10-8-5-7(11)4-6-2-1-3-12-9(6)8/h3-4,8H,1-2,5,11H2 |
| InChIKey | ATHATUFJFCAYKM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |