About (E)-N-(1-phenylethenoxy)-2,3-dihydroinden-1-imine
(E)-N-(1-phenylethenoxy)-2,3-dihydroinden-1-imine (PubChem CID 89209386) has the molecular formula C17H15NO
and a molecular weight of 249.31 g/mol. Its IUPAC name is (E)-N-(1-phenylethenoxy)-2,3-dihydroinden-1-imine.
Molecular Properties
| Compound Name | (E)-N-(1-phenylethenoxy)-2,3-dihydroinden-1-imine |
| PubChem CID | 89209386 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (E)-N-(1-phenylethenoxy)-2,3-dihydroinden-1-imine |
| SMILES | C=C(O/N=C1\CCc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C17H15NO/c1-13(14-7-3-2-4-8-14)19-18-17-12-11-15-9-5-6-10-16(15)17/h2-10H,1,11-12H2/b18-17+ |
| InChIKey | PAPZTBGLWRVNFN-ISLYRVAYSA-N |
| XLogP | 4.02 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(1-phenylethenoxy)-2,3-dihydroinden-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(1-phenylethenoxy)-2,3-dihydroinden-1-imine?
The IUPAC name of (E)-N-(1-phenylethenoxy)-2,3-dihydroinden-1-imine (CID 89209386) is (E)-N-(1-phenylethenoxy)-2,3-dihydroinden-1-imine.
What is the SMILES notation for (E)-N-(1-phenylethenoxy)-2,3-dihydroinden-1-imine?
The canonical SMILES for (E)-N-(1-phenylethenoxy)-2,3-dihydroinden-1-imine is C=C(O/N=C1\CCc2ccccc21)c1ccccc1.
What is the InChIKey of (E)-N-(1-phenylethenoxy)-2,3-dihydroinden-1-imine?
The InChIKey is PAPZTBGLWRVNFN-ISLYRVAYSA-N. The full InChI is InChI=1S/C17H15NO/c1-13(14-7-3-2-4-8-14)19-18-17-12-11-15-9-5-6-10-16(15)17/h2-10H,1,11-12H2/b18-17+.
What are the key properties of (E)-N-(1-phenylethenoxy)-2,3-dihydroinden-1-imine?
(E)-N-(1-phenylethenoxy)-2,3-dihydroinden-1-imine has a molecular weight of 249.31 g/mol, XLogP of 4.02, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(1-phenylethenoxy)-2,3-dihydroinden-1-imine is sourced from PubChem (CID 89209386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).