C12H22N2 — CID 89209429
N'-[(3E,5E)-hepta-1,3,5-trien-4-yl]pentane-1,5-diamine (PubChem CID 89209429) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is N'-[(3E,5E)-hepta-1,3,5-trien-4-yl]pentane-1,5-diamine.
| Compound Name | N'-[(3E,5E)-hepta-1,3,5-trien-4-yl]pentane-1,5-diamine |
|---|---|
| PubChem CID | 89209429 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N'-[(3E,5E)-hepta-1,3,5-trien-4-yl]pentane-1,5-diamine |
| SMILES | C=C/C=C(\C=C\C)NCCCCCN |
| InChI | InChI=1S/C12H22N2/c1-3-8-12(9-4-2)14-11-7-5-6-10-13/h3-4,8-9,14H,1,5-7,10-11,13H2,2H3/b9-4+,12-8+ |
| InChIKey | BPPCFVAETFZTGG-FMQHCKNKSA-N |
| XLogP | 2.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|