About (E,6S)-N,6-dimethyloct-2-en-3-amine
(E,6S)-N,6-dimethyloct-2-en-3-amine (PubChem CID 89209438) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is (E,6S)-N,6-dimethyloct-2-en-3-amine.
Molecular Properties
| Compound Name | (E,6S)-N,6-dimethyloct-2-en-3-amine |
| PubChem CID | 89209438 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | (E,6S)-N,6-dimethyloct-2-en-3-amine |
| SMILES | C/C=C(\CC[C@@H](C)CC)NC |
| InChI | InChI=1S/C10H21N/c1-5-9(3)7-8-10(6-2)11-4/h6,9,11H,5,7-8H2,1-4H3/b10-6+/t9-/m0/s1 |
| InChIKey | QYVSXJPDFSABCG-CMWXKVOJSA-N |
| XLogP | 2.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E,6S)-N,6-dimethyloct-2-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,6S)-N,6-dimethyloct-2-en-3-amine?
The IUPAC name of (E,6S)-N,6-dimethyloct-2-en-3-amine (CID 89209438) is (E,6S)-N,6-dimethyloct-2-en-3-amine.
What is the SMILES notation for (E,6S)-N,6-dimethyloct-2-en-3-amine?
The canonical SMILES for (E,6S)-N,6-dimethyloct-2-en-3-amine is C/C=C(\CC[C@@H](C)CC)NC.
What is the InChIKey of (E,6S)-N,6-dimethyloct-2-en-3-amine?
The InChIKey is QYVSXJPDFSABCG-CMWXKVOJSA-N. The full InChI is InChI=1S/C10H21N/c1-5-9(3)7-8-10(6-2)11-4/h6,9,11H,5,7-8H2,1-4H3/b10-6+/t9-/m0/s1.
What are the key properties of (E,6S)-N,6-dimethyloct-2-en-3-amine?
(E,6S)-N,6-dimethyloct-2-en-3-amine has a molecular weight of 155.28 g/mol, XLogP of 2.94, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E,6S)-N,6-dimethyloct-2-en-3-amine is sourced from PubChem (CID 89209438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).