About 5-(5-chlorocyclohexa-2,4-dien-1-yl)hexan-2-imine
5-(5-chlorocyclohexa-2,4-dien-1-yl)hexan-2-imine (PubChem CID 89209460) has the molecular formula C12H18ClN
and a molecular weight of 211.74 g/mol. Its IUPAC name is 5-(5-chlorocyclohexa-2,4-dien-1-yl)hexan-2-imine.
Molecular Properties
| Compound Name | 5-(5-chlorocyclohexa-2,4-dien-1-yl)hexan-2-imine |
| PubChem CID | 89209460 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 5-(5-chlorocyclohexa-2,4-dien-1-yl)hexan-2-imine |
| SMILES | [H]/N=C(\C)CCC(C)C1C=CC=C(Cl)C1 |
| InChI | InChI=1S/C12H18ClN/c1-9(6-7-10(2)14)11-4-3-5-12(13)8-11/h3-5,9,11,14H,6-8H2,1-2H3/b14-10+ |
| InChIKey | JBBYBCRERYADHN-GXDHUFHOSA-N |
| XLogP | 4.14 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-(5-chlorocyclohexa-2,4-dien-1-yl)hexan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-chlorocyclohexa-2,4-dien-1-yl)hexan-2-imine?
The IUPAC name of 5-(5-chlorocyclohexa-2,4-dien-1-yl)hexan-2-imine (CID 89209460) is 5-(5-chlorocyclohexa-2,4-dien-1-yl)hexan-2-imine.
What is the SMILES notation for 5-(5-chlorocyclohexa-2,4-dien-1-yl)hexan-2-imine?
The canonical SMILES for 5-(5-chlorocyclohexa-2,4-dien-1-yl)hexan-2-imine is [H]/N=C(\C)CCC(C)C1C=CC=C(Cl)C1.
What is the InChIKey of 5-(5-chlorocyclohexa-2,4-dien-1-yl)hexan-2-imine?
The InChIKey is JBBYBCRERYADHN-GXDHUFHOSA-N. The full InChI is InChI=1S/C12H18ClN/c1-9(6-7-10(2)14)11-4-3-5-12(13)8-11/h3-5,9,11,14H,6-8H2,1-2H3/b14-10+.
What are the key properties of 5-(5-chlorocyclohexa-2,4-dien-1-yl)hexan-2-imine?
5-(5-chlorocyclohexa-2,4-dien-1-yl)hexan-2-imine has a molecular weight of 211.74 g/mol, XLogP of 4.14, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-chlorocyclohexa-2,4-dien-1-yl)hexan-2-imine is sourced from PubChem (CID 89209460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).