C8H16N2 — CID 89209473
(Z)-2-(C,N-dimethylcarbonimidoyl)-3-methylbut-1-en-1-amine (PubChem CID 89209473) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is (Z)-2-(C,N-dimethylcarbonimidoyl)-3-methylbut-1-en-1-amine.
| Compound Name | (Z)-2-(C,N-dimethylcarbonimidoyl)-3-methylbut-1-en-1-amine |
|---|---|
| PubChem CID | 89209473 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (Z)-2-(C,N-dimethylcarbonimidoyl)-3-methylbut-1-en-1-amine |
| SMILES | C/N=C(C)/C(=C\N)C(C)C |
| InChI | InChI=1S/C8H16N2/c1-6(2)8(5-9)7(3)10-4/h5-6H,9H2,1-4H3/b8-5-,10-7+ |
| InChIKey | MHSINBYNWSIYII-OEPUHGBTSA-N |
| XLogP | 1.58 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|