C24H46O5Si — CID 89209582
(2S,4S,5R,6S,7E,9S,10S)-9-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-4,5,10-trimethoxy-2,6,8-trimethyldodeca-7,11-dienal (PubChem CID 89209582) has the molecular formula C24H46O5Si and a molecular weight of 442.71 g/mol. Its IUPAC name is (2S,4S,5R,6S,7E,9S,10S)-9-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-4,5,10-trimethoxy-2,6,8-trimethyldodeca-7,11-dienal.
| Compound Name | (2S,4S,5R,6S,7E,9S,10S)-9-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-4,5,10-trimethoxy-2,6,8-trimethyldodeca-7,11-dienal |
|---|---|
| PubChem CID | 89209582 |
| Molecular Formula | C24H46O5Si |
| Molecular Weight | 442.71 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | (2S,4S,5R,6S,7E,9S,10S)-9-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-4,5,10-trimethoxy-2,6,8-trimethyldodeca-7,11-dienal |
| SMILES | C=C[C@H](OC)[C@@H](CC(C)(C)[Si](C)(C)O)/C(C)=C/[C@H](C)[C@@H](OC)[C@H](CC(C)C=O)OC |
| InChI | InChI=1S/C24H46O5Si/c1-12-21(27-7)20(15-24(5,6)30(10,11)26)18(3)14-19(4)23(29-9)22(28-8)13-17(2)16-25/h12,14,16-17,19-23,26H,1,13,15H2,2-11H3/b18-14+/t17?,19-,20-,21-,22-,23+/m0/s1 |
| InChIKey | FWEMTBZFDMSLBY-ZVVGVQRYSA-N |
| XLogP | 5.01 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.71 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|