C9H11F3O — CID 89209626
(3E,5Z)-3-ethenyl-1,1,1-trifluorohepta-3,5-dien-2-ol (PubChem CID 89209626) has the molecular formula C9H11F3O and a molecular weight of 192.18 g/mol. Its IUPAC name is (3E,5Z)-3-ethenyl-1,1,1-trifluorohepta-3,5-dien-2-ol.
| Compound Name | (3E,5Z)-3-ethenyl-1,1,1-trifluorohepta-3,5-dien-2-ol |
|---|---|
| PubChem CID | 89209626 |
| Molecular Formula | C9H11F3O |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (3E,5Z)-3-ethenyl-1,1,1-trifluorohepta-3,5-dien-2-ol |
| SMILES | C=C/C(=C\C=C/C)C(O)C(F)(F)F |
| InChI | InChI=1S/C9H11F3O/c1-3-5-6-7(4-2)8(13)9(10,11)12/h3-6,8,13H,2H2,1H3/b5-3-,7-6+ |
| InChIKey | TVNHLTJXXQHWSW-AIJKMKQJSA-N |
| XLogP | 2.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|