C9H8N4 — CID 89209681
4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaene (PubChem CID 89209681) has the molecular formula C9H8N4 and a molecular weight of 172.19 g/mol. Its IUPAC name is 4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaene.
| Compound Name | 4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaene |
|---|---|
| PubChem CID | 89209681 |
| Molecular Formula | C9H8N4 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaene |
| SMILES | C1=NCNc2[nH]c3cnccc3c21 |
| InChI | InChI=1S/C9H8N4/c1-2-10-4-8-6(1)7-3-11-5-12-9(7)13-8/h1-4,12-13H,5H2 |
| InChIKey | QROKRPHFNHJMCR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |