C32H45NO6 — CID 89209805
[(3Z,6S,7S,8R,9S,11Z,13S,14S,16Z)-8,14-dihydroxy-7,9,11,13,15-pentamethyl-17-(2-oxochromen-7-yl)heptadeca-3,11,16-trien-6-yl] carbamate (PubChem CID 89209805) has the molecular formula C32H45NO6 and a molecular weight of 539.71 g/mol. Its IUPAC name is [(3Z,6S,7S,8R,9S,11Z,13S,14S,16Z)-8,14-dihydroxy-7,9,11,13,15-pentamethyl-17-(2-oxochromen-7-yl)heptadeca-3,11,16-trien-6-yl] carbamate.
| Compound Name | [(3Z,6S,7S,8R,9S,11Z,13S,14S,16Z)-8,14-dihydroxy-7,9,11,13,15-pentamethyl-17-(2-oxochromen-7-yl)heptadeca-3,11,16-trien-6-yl] carbamate |
|---|---|
| PubChem CID | 89209805 |
| Molecular Formula | C32H45NO6 |
| Molecular Weight | 539.71 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | [(3Z,6S,7S,8R,9S,11Z,13S,14S,16Z)-8,14-dihydroxy-7,9,11,13,15-pentamethyl-17-(2-oxochromen-7-yl)heptadeca-3,11,16-trien-6-yl] carbamate |
| SMILES | CC/C=C\C[C@H](OC(N)=O)[C@@H](C)[C@H](O)[C@@H](C)C/C(C)=C\[C@H](C)[C@@H](O)C(C)/C=C\c1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C32H45NO6/c1-7-8-9-10-27(39-32(33)37)24(6)31(36)23(5)18-20(2)17-22(4)30(35)21(3)11-12-25-13-14-26-15-16-29(34)38-28(26)19-25/h8-9,11-17,19,21-24,27,30-31,35-36H,7,10,18H2,1-6H3,(H2,33,37)/b9-8-,12-11-,20-17-/t21?,22-,23-,24+,27-,30-,31+/m0/s1 |
| InChIKey | PTKPCZCXLOSLMV-ASMHKGIQSA-N |
| XLogP | 6.23 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.71 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|