C31H49N3O — CID 89209971
2-[1-[2-[cyclohexa-1,3-dien-1-yl(cyclohex-3-en-1-yl)amino]ethyl]piperidin-4-yl]-N-[(4E,6Z)-2,3-dimethylocta-4,6-dien-4-yl]acetamide (PubChem CID 89209971) has the molecular formula C31H49N3O and a molecular weight of 479.75 g/mol. Its IUPAC name is 2-[1-[2-[cyclohexa-1,3-dien-1-yl(cyclohex-3-en-1-yl)amino]ethyl]piperidin-4-yl]-N-[(4E,6Z)-2,3-dimethylocta-4,6-dien-4-yl]acetamide.
| Compound Name | 2-[1-[2-[cyclohexa-1,3-dien-1-yl(cyclohex-3-en-1-yl)amino]ethyl]piperidin-4-yl]-N-[(4E,6Z)-2,3-dimethylocta-4,6-dien-4-yl]acetamide |
|---|---|
| PubChem CID | 89209971 |
| Molecular Formula | C31H49N3O |
| Molecular Weight | 479.75 g/mol |
| Exact Mass | 479.39 |
| IUPAC Name | 2-[1-[2-[cyclohexa-1,3-dien-1-yl(cyclohex-3-en-1-yl)amino]ethyl]piperidin-4-yl]-N-[(4E,6Z)-2,3-dimethylocta-4,6-dien-4-yl]acetamide |
| SMILES | C/C=C\C=C(\NC(=O)CC1CCN(CCN(C2=CC=CCC2)C2CC=CCC2)CC1)C(C)C(C)C |
| InChI | InChI=1S/C31H49N3O/c1-5-6-17-30(26(4)25(2)3)32-31(35)24-27-18-20-33(21-19-27)22-23-34(28-13-9-7-10-14-28)29-15-11-8-12-16-29/h5-9,11,13,17,25-27,29H,10,12,14-16,18-24H2,1-4H3,(H,32,35)/b6-5-,30-17+ |
| InChIKey | TWDMLRFGKNKRPH-ASYANAGJSA-N |
| XLogP | 6.60 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.75 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|