C29H35F3N6O3 — CID 89210042
(2E,4Z)-6-[amino-[(Z)-2-amino-2-(5-methoxy-3-pyridinyl)ethenyl]amino]-N-[3-[(cyclopropylamino)methyl]-2-methoxy-5-(trifluoromethyl)phenyl]-2,5-dimethylhepta-2,4,6-trienamide (PubChem CID 89210042) has the molecular formula C29H35F3N6O3 and a molecular weight of 572.63 g/mol. Its IUPAC name is (2E,4Z)-6-[amino-[(Z)-2-amino-2-(5-methoxy-3-pyridinyl)ethenyl]amino]-N-[3-[(cyclopropylamino)methyl]-2-methoxy-5-(trifluoromethyl)phenyl]-2,5-dimethylhepta-2,4,6-trienamide.
| Compound Name | (2E,4Z)-6-[amino-[(Z)-2-amino-2-(5-methoxy-3-pyridinyl)ethenyl]amino]-N-[3-[(cyclopropylamino)methyl]-2-methoxy-5-(trifluoromethyl)phenyl]-2,5-dimethylhepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 89210042 |
| Molecular Formula | C29H35F3N6O3 |
| Molecular Weight | 572.63 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | (2E,4Z)-6-[amino-[(Z)-2-amino-2-(5-methoxy-3-pyridinyl)ethenyl]amino]-N-[3-[(cyclopropylamino)methyl]-2-methoxy-5-(trifluoromethyl)phenyl]-2,5-dimethylhepta-2,4,6-trienamide |
| SMILES | C=C(/C(C)=C\C=C(/C)C(=O)Nc1cc(C(F)(F)F)cc(CNC2CC2)c1OC)N(N)/C=C(\N)c1cncc(OC)c1 |
| InChI | InChI=1S/C29H35F3N6O3/c1-17(19(3)38(34)16-25(33)20-11-24(40-4)15-35-13-20)6-7-18(2)28(39)37-26-12-22(29(30,31)32)10-21(27(26)41-5)14-36-23-8-9-23/h6-7,10-13,15-16,23,36H,3,8-9,14,33-34H2,1-2,4-5H3,(H,37,39)/b17-6-,18-7+,25-16- |
| InChIKey | OTMBZOMVDSKCFY-SSQCOBJQSA-N |
| XLogP | 4.85 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|