C31H42O7S2 — CID 89211115
[(8R,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-[3-(methylsulfonyloxymethyl)phenyl]sulfanylacetate (PubChem CID 89211115) has the molecular formula C31H42O7S2 and a molecular weight of 590.80 g/mol. Its IUPAC name is [(8R,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-[3-(methylsulfonyloxymethyl)phenyl]sulfanylacetate.
| Compound Name | [(8R,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-[3-(methylsulfonyloxymethyl)phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 89211115 |
| Molecular Formula | C31H42O7S2 |
| Molecular Weight | 590.80 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | [(8R,9R,11S,12S,13R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] 2-[3-(methylsulfonyloxymethyl)phenyl]sulfanylacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CSc2cccc(COS(C)(=O)=O)c2)C2(C)C(C)CC34CC(CCC3=O)(C42)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C31H42O7S2/c1-7-28(4)15-24(38-25(33)17-39-22-10-8-9-21(13-22)16-37-40(6,35)36)29(5)19(2)14-31-18-30(27(29)31,12-11-23(31)32)20(3)26(28)34/h7-10,13,19-20,24,26-27,34H,1,11-12,14-18H2,2-6H3/t19?,20-,24+,26-,27?,28+,29?,30?,31?/m0/s1 |
| InChIKey | ALCDLLPMDVPNJL-QOXZTMMYSA-N |
| XLogP | 5.16 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.80 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|