About cyclohexyloxymethyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate
cyclohexyloxymethyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate (PubChem CID 89211192) has the molecular formula C18H28O5
and a molecular weight of 324.42 g/mol. Its IUPAC name is cyclohexyloxymethyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | cyclohexyloxymethyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate |
| PubChem CID | 89211192 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | cyclohexyloxymethyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC1CCC(C(=O)OCOC2CCCCC2)CC1 |
| InChI | InChI=1S/C18H28O5/c1-13(2)17(19)23-16-10-8-14(9-11-16)18(20)22-12-21-15-6-4-3-5-7-15/h14-16H,1,3-12H2,2H3 |
| InChIKey | HCDQPWSHCXDUKX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyloxymethyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyloxymethyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate?
The IUPAC name of cyclohexyloxymethyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate (CID 89211192) is cyclohexyloxymethyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate.
What is the SMILES notation for cyclohexyloxymethyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate?
The canonical SMILES for cyclohexyloxymethyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate is C=C(C)C(=O)OC1CCC(C(=O)OCOC2CCCCC2)CC1.
What is the InChIKey of cyclohexyloxymethyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate?
The InChIKey is HCDQPWSHCXDUKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O5/c1-13(2)17(19)23-16-10-8-14(9-11-16)18(20)22-12-21-15-6-4-3-5-7-15/h14-16H,1,3-12H2,2H3.
What are the key properties of cyclohexyloxymethyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate?
cyclohexyloxymethyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate has a molecular weight of 324.42 g/mol, XLogP of 3.51, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyloxymethyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate is sourced from PubChem (CID 89211192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).