C14H17F3 — CID 89211227
1-methyl-3-methylidene-2-[(1Z,3Z)-6,6,6-trifluorohexa-1,3-dienyl]cyclohexene (PubChem CID 89211227) has the molecular formula C14H17F3 and a molecular weight of 242.28 g/mol. Its IUPAC name is 1-methyl-3-methylidene-2-[(1Z,3Z)-6,6,6-trifluorohexa-1,3-dienyl]cyclohexene.
| Compound Name | 1-methyl-3-methylidene-2-[(1Z,3Z)-6,6,6-trifluorohexa-1,3-dienyl]cyclohexene |
|---|---|
| PubChem CID | 89211227 |
| Molecular Formula | C14H17F3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1-methyl-3-methylidene-2-[(1Z,3Z)-6,6,6-trifluorohexa-1,3-dienyl]cyclohexene |
| SMILES | C=C1CCCC(C)=C1/C=C\C=C/CC(F)(F)F |
| InChI | InChI=1S/C14H17F3/c1-11-7-6-8-12(2)13(11)9-4-3-5-10-14(15,16)17/h3-5,9H,1,6-8,10H2,2H3/b5-3-,9-4- |
| InChIKey | NAKLYMNDTVBOAD-SIJZXUBCSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|