C16H26O — CID 89211252
(1S,2R,4R,5S)-1,2,4,8-tetramethyl-5-prop-1-en-2-ylbicyclo[3.3.1]non-7-en-2-ol (PubChem CID 89211252) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (1S,2R,4R,5S)-1,2,4,8-tetramethyl-5-prop-1-en-2-ylbicyclo[3.3.1]non-7-en-2-ol.
| Compound Name | (1S,2R,4R,5S)-1,2,4,8-tetramethyl-5-prop-1-en-2-ylbicyclo[3.3.1]non-7-en-2-ol |
|---|---|
| PubChem CID | 89211252 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (1S,2R,4R,5S)-1,2,4,8-tetramethyl-5-prop-1-en-2-ylbicyclo[3.3.1]non-7-en-2-ol |
| SMILES | C=C(C)[C@@]12CC=C(C)[C@](C)(C1)[C@](C)(O)C[C@H]2C |
| InChI | InChI=1S/C16H26O/c1-11(2)16-8-7-12(3)14(5,10-16)15(6,17)9-13(16)4/h7,13,17H,1,8-10H2,2-6H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | BJELMKGVAIKQNR-QKPAOTATSA-N |
| XLogP | 4.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|