C59H57N5O2Si2 — CID 89211712
tert-butyl-[5-[10-[8-[tert-butyl(dimethyl)silyl]oxyquinolin-5-yl]-2-(4,6-diphenyl-1,3,5-triazin-2-yl)anthracen-9-yl]quinolin-8-yl]oxy-dimethylsilane (PubChem CID 89211712) has the molecular formula C59H57N5O2Si2 and a molecular weight of 924.31 g/mol. Its IUPAC name is tert-butyl-[5-[10-[8-[tert-butyl(dimethyl)silyl]oxyquinolin-5-yl]-2-(4,6-diphenyl-1,3,5-triazin-2-yl)anthracen-9-yl]quinolin-8-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[5-[10-[8-[tert-butyl(dimethyl)silyl]oxyquinolin-5-yl]-2-(4,6-diphenyl-1,3,5-triazin-2-yl)anthracen-9-yl]quinolin-8-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 89211712 |
| Molecular Formula | C59H57N5O2Si2 |
| Molecular Weight | 924.31 g/mol |
| Exact Mass | 923.41 |
| IUPAC Name | tert-butyl-[5-[10-[8-[tert-butyl(dimethyl)silyl]oxyquinolin-5-yl]-2-(4,6-diphenyl-1,3,5-triazin-2-yl)anthracen-9-yl]quinolin-8-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(-c2c3ccccc3c(-c3ccc(O[Si](C)(C)C(C)(C)C)c4ncccc34)c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc23)c2cccnc12 |
| InChI | InChI=1S/C59H57N5O2Si2/c1-58(2,3)67(7,8)65-49-33-31-43(46-27-19-35-60-53(46)49)51-41-25-17-18-26-42(41)52(44-32-34-50(54-47(44)28-20-36-61-54)66-68(9,10)59(4,5)6)48-37-40(29-30-45(48)51)57-63-55(38-21-13-11-14-22-38)62-56(64-57)39-23-15-12-16-24-39/h11-37H,1-10H3 |
| InChIKey | BHKSZFQSXJLXPG-UHFFFAOYSA-N |
| XLogP | 16.38 |
| TPSA | 82.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.31 |
| LogP ≤ 5 | 16.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|