C26H15F5N2 — CID 89211852
20,20-dimethyl-3-(2,3,4,5,6-pentafluorophenyl)-3,8-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaene (PubChem CID 89211852) has the molecular formula C26H15F5N2 and a molecular weight of 450.41 g/mol. Its IUPAC name is 20,20-dimethyl-3-(2,3,4,5,6-pentafluorophenyl)-3,8-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaene.
| Compound Name | 20,20-dimethyl-3-(2,3,4,5,6-pentafluorophenyl)-3,8-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 89211852 |
| Molecular Formula | C26H15F5N2 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 20,20-dimethyl-3-(2,3,4,5,6-pentafluorophenyl)-3,8-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2(10),4(9),5,7,11,14,16,18-nonaene |
| SMILES | CC1(C)c2ccccc2-c2ccc3c4ncccc4n(-c4c(F)c(F)c(F)c(F)c4F)c3c21 |
| InChI | InChI=1S/C26H15F5N2/c1-26(2)15-7-4-3-6-12(15)13-9-10-14-23-16(8-5-11-32-23)33(24(14)17(13)26)25-21(30)19(28)18(27)20(29)22(25)31/h3-11H,1-2H3 |
| InChIKey | WAPYNOHGTUSTND-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|