C63H118N4 — CID 89212220
(9Z,12Z)-N-[2-[4-[2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethyl]piperazin-1-yl]ethyl]-N-methyloctadeca-9,12-dien-1-amine (PubChem CID 89212220) has the molecular formula C63H118N4 and a molecular weight of 931.66 g/mol. Its IUPAC name is (9Z,12Z)-N-[2-[4-[2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethyl]piperazin-1-yl]ethyl]-N-methyloctadeca-9,12-dien-1-amine.
| Compound Name | (9Z,12Z)-N-[2-[4-[2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethyl]piperazin-1-yl]ethyl]-N-methyloctadeca-9,12-dien-1-amine |
|---|---|
| PubChem CID | 89212220 |
| Molecular Formula | C63H118N4 |
| Molecular Weight | 931.66 g/mol |
| Exact Mass | 930.94 |
| IUPAC Name | (9Z,12Z)-N-[2-[4-[2-[bis[(9Z,12Z)-octadeca-9,12-dienyl]amino]ethyl]piperazin-1-yl]ethyl]-N-methyloctadeca-9,12-dien-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(C)CCN1CCN(CCN(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCCCCC/C=C\C/C=C\CCCCC)CC1 |
| InChI | InChI=1S/C63H118N4/c1-5-8-11-14-17-20-23-26-29-32-35-38-41-44-47-50-53-64(4)56-57-66-60-62-67(63-61-66)59-58-65(54-51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-2)55-52-49-46-43-40-37-34-31-28-25-22-19-16-13-10-7-3/h17-22,26-31H,5-16,23-25,32-63H2,1-4H3/b20-17-,21-18-,22-19-,29-26-,30-27-,31-28- |
| InChIKey | MPCFITKKPLFUOI-IXQWNJBLSA-N |
| XLogP | 18.28 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 931.66 |
| LogP ≤ 5 | 18.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|