About 6,7-bis(sulfanyl)anthracene-2,3-dicarbonitrile
6,7-bis(sulfanyl)anthracene-2,3-dicarbonitrile (PubChem CID 89212287) has the molecular formula C16H8N2S2
and a molecular weight of 292.39 g/mol. Its IUPAC name is 6,7-bis(sulfanyl)anthracene-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 6,7-bis(sulfanyl)anthracene-2,3-dicarbonitrile |
| PubChem CID | 89212287 |
| Molecular Formula | C16H8N2S2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 6,7-bis(sulfanyl)anthracene-2,3-dicarbonitrile |
| SMILES | N#Cc1cc2cc3cc(S)c(S)cc3cc2cc1C#N |
| InChI | InChI=1S/C16H8N2S2/c17-7-13-3-9-1-11-5-15(19)16(20)6-12(11)2-10(9)4-14(13)8-18/h1-6,19-20H |
| InChIKey | BNEOUWGBFMJAGB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6,7-bis(sulfanyl)anthracene-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-bis(sulfanyl)anthracene-2,3-dicarbonitrile?
The IUPAC name of 6,7-bis(sulfanyl)anthracene-2,3-dicarbonitrile (CID 89212287) is 6,7-bis(sulfanyl)anthracene-2,3-dicarbonitrile.
What is the SMILES notation for 6,7-bis(sulfanyl)anthracene-2,3-dicarbonitrile?
The canonical SMILES for 6,7-bis(sulfanyl)anthracene-2,3-dicarbonitrile is N#Cc1cc2cc3cc(S)c(S)cc3cc2cc1C#N.
What is the InChIKey of 6,7-bis(sulfanyl)anthracene-2,3-dicarbonitrile?
The InChIKey is BNEOUWGBFMJAGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8N2S2/c17-7-13-3-9-1-11-5-15(19)16(20)6-12(11)2-10(9)4-14(13)8-18/h1-6,19-20H.
What are the key properties of 6,7-bis(sulfanyl)anthracene-2,3-dicarbonitrile?
6,7-bis(sulfanyl)anthracene-2,3-dicarbonitrile has a molecular weight of 292.39 g/mol, XLogP of 4.31, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-bis(sulfanyl)anthracene-2,3-dicarbonitrile is sourced from PubChem (CID 89212287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).