C8H12Br2N2O4 — CID 89212340
3,6-bis(bromomethyl)-3,6-dihydroxy-1,4-dimethylpiperazine-2,5-dione (PubChem CID 89212340) has the molecular formula C8H12Br2N2O4 and a molecular weight of 360.00 g/mol. Its IUPAC name is 3,6-bis(bromomethyl)-3,6-dihydroxy-1,4-dimethylpiperazine-2,5-dione.
| Compound Name | 3,6-bis(bromomethyl)-3,6-dihydroxy-1,4-dimethylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 89212340 |
| Molecular Formula | C8H12Br2N2O4 |
| Molecular Weight | 360.00 g/mol |
| Exact Mass | 357.92 |
| IUPAC Name | 3,6-bis(bromomethyl)-3,6-dihydroxy-1,4-dimethylpiperazine-2,5-dione |
| SMILES | CN1C(=O)C(O)(CBr)N(C)C(=O)C1(O)CBr |
| InChI | InChI=1S/C8H12Br2N2O4/c1-11-5(13)8(16,4-10)12(2)6(14)7(11,15)3-9/h15-16H,3-4H2,1-2H3 |
| InChIKey | BJHGPKRJLYRROQ-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.00 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|