C25H23Cl3N2O9 — CID 89212410
ethyl 4-[(E)-3-[2-(4-hydroxy-3-oxopentyl)-2-methyl-4,6-dioxo-1,3-dioxan-5-ylidene]prop-1-enyl]-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazole-5-carboxylate (PubChem CID 89212410) has the molecular formula C25H23Cl3N2O9 and a molecular weight of 601.82 g/mol. Its IUPAC name is ethyl 4-[(E)-3-[2-(4-hydroxy-3-oxopentyl)-2-methyl-4,6-dioxo-1,3-dioxan-5-ylidene]prop-1-enyl]-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 4-[(E)-3-[2-(4-hydroxy-3-oxopentyl)-2-methyl-4,6-dioxo-1,3-dioxan-5-ylidene]prop-1-enyl]-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 89212410 |
| Molecular Formula | C25H23Cl3N2O9 |
| Molecular Weight | 601.82 g/mol |
| Exact Mass | 600.05 |
| IUPAC Name | ethyl 4-[(E)-3-[2-(4-hydroxy-3-oxopentyl)-2-methyl-4,6-dioxo-1,3-dioxan-5-ylidene]prop-1-enyl]-3-oxo-2-(2,4,6-trichlorophenyl)-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]n(-c2c(Cl)cc(Cl)cc2Cl)c(=O)c1/C=C/C=C1C(=O)OC(C)(CCC(=O)C(C)O)OC1=O |
| InChI | InChI=1S/C25H23Cl3N2O9/c1-4-37-24(36)19-14(21(33)30(29-19)20-16(27)10-13(26)11-17(20)28)6-5-7-15-22(34)38-25(3,39-23(15)35)9-8-18(32)12(2)31/h5-7,10-12,29,31H,4,8-9H2,1-3H3/b6-5+,15-7- |
| InChIKey | JWMJOMDVNDXBEW-QWZNWYIFSA-N |
| XLogP | 3.79 |
| TPSA | 153.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.82 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|