C40H32N2 — CID 89212483
2,3,4,5,6-pentadeuterio-N-[4-[4-(4-ethenyl-N-(2,3,4,5,6-pentadeuteriophenyl)anilino)phenyl]phenyl]-N-(4-ethenylphenyl)aniline (PubChem CID 89212483) has the molecular formula C40H32N2 and a molecular weight of 550.77 g/mol. Its IUPAC name is 2,3,4,5,6-pentadeuterio-N-[4-[4-(4-ethenyl-N-(2,3,4,5,6-pentadeuteriophenyl)anilino)phenyl]phenyl]-N-(4-ethenylphenyl)aniline.
| Compound Name | 2,3,4,5,6-pentadeuterio-N-[4-[4-(4-ethenyl-N-(2,3,4,5,6-pentadeuteriophenyl)anilino)phenyl]phenyl]-N-(4-ethenylphenyl)aniline |
|---|---|
| PubChem CID | 89212483 |
| Molecular Formula | C40H32N2 |
| Molecular Weight | 550.77 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | 2,3,4,5,6-pentadeuterio-N-[4-[4-(4-ethenyl-N-(2,3,4,5,6-pentadeuteriophenyl)anilino)phenyl]phenyl]-N-(4-ethenylphenyl)aniline |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2ccc(C=C)cc2)c2ccc(-c3ccc(N(c4ccc(C=C)cc4)c4c([2H])c([2H])c([2H])c([2H])c4[2H])cc3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C40H32N2/c1-3-31-15-23-37(24-16-31)41(35-11-7-5-8-12-35)39-27-19-33(20-28-39)34-21-29-40(30-22-34)42(36-13-9-6-10-14-36)38-25-17-32(4-2)18-26-38/h3-30H,1-2H2/i5D,6D,7D,8D,9D,10D,11D,12D,13D,14D |
| InChIKey | ZMKSBYFFLFEYSO-FBOMCFBCSA-N |
| XLogP | 11.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.77 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |