C19H17N5O3 — CID 89212502
[6-(2-amino-1,3-benzoxazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)methanone (PubChem CID 89212502) has the molecular formula C19H17N5O3 and a molecular weight of 371.43 g/mol. Its IUPAC name is [6-(2-amino-1,3-benzoxazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)methanone.
| Compound Name | [6-(2-amino-1,3-benzoxazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 89212502 |
| Molecular Formula | C19H17N5O3 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | [6-(2-amino-1,3-benzoxazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)methanone |
| SMILES | [2H]C1([2H])OC([2H])([2H])C([2H])([2H])N(C(=O)c2cnc3ccc(-c4ccc5oc(N)nc5c4)cn23)C1([2H])[2H] |
| InChI | InChI=1S/C19H17N5O3/c20-19-22-14-9-12(1-3-16(14)27-19)13-2-4-17-21-10-15(24(17)11-13)18(25)23-5-7-26-8-6-23/h1-4,9-11H,5-8H2,(H2,20,22)/i5D2,6D2,7D2,8D2 |
| InChIKey | BLGWHBSBBJNKJO-YEBVBAJPSA-N |
| XLogP | 2.20 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |