About N-[4,5,10-tris(ethylideneamino)phenanthren-1-yl]ethanimine
N-[4,5,10-tris(ethylideneamino)phenanthren-1-yl]ethanimine (PubChem CID 89212590) has the molecular formula C22H22N4
and a molecular weight of 342.45 g/mol. Its IUPAC name is N-[4,5,10-tris(ethylideneamino)phenanthren-1-yl]ethanimine.
Molecular Properties
| Compound Name | N-[4,5,10-tris(ethylideneamino)phenanthren-1-yl]ethanimine |
| PubChem CID | 89212590 |
| Molecular Formula | C22H22N4 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | N-[4,5,10-tris(ethylideneamino)phenanthren-1-yl]ethanimine |
| SMILES | C/C=N\c1cccc2cc(/N=C/C)c3c(/N=C/C)ccc(/N=C/C)c3c12 |
| InChI | InChI=1S/C22H22N4/c1-5-23-16-11-9-10-15-14-19(26-8-4)21-17(24-6-2)12-13-18(25-7-3)22(21)20(15)16/h5-14H,1-4H3/b23-5-,24-6+,25-7+,26-8+ |
| InChIKey | IJZZOGGMDZNRKF-MCIBDYFSSA-N |
| XLogP | 6.88 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze N-[4,5,10-tris(ethylideneamino)phenanthren-1-yl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4,5,10-tris(ethylideneamino)phenanthren-1-yl]ethanimine?
The IUPAC name of N-[4,5,10-tris(ethylideneamino)phenanthren-1-yl]ethanimine (CID 89212590) is N-[4,5,10-tris(ethylideneamino)phenanthren-1-yl]ethanimine.
What is the SMILES notation for N-[4,5,10-tris(ethylideneamino)phenanthren-1-yl]ethanimine?
The canonical SMILES for N-[4,5,10-tris(ethylideneamino)phenanthren-1-yl]ethanimine is C/C=N\c1cccc2cc(/N=C/C)c3c(/N=C/C)ccc(/N=C/C)c3c12.
What is the InChIKey of N-[4,5,10-tris(ethylideneamino)phenanthren-1-yl]ethanimine?
The InChIKey is IJZZOGGMDZNRKF-MCIBDYFSSA-N. The full InChI is InChI=1S/C22H22N4/c1-5-23-16-11-9-10-15-14-19(26-8-4)21-17(24-6-2)12-13-18(25-7-3)22(21)20(15)16/h5-14H,1-4H3/b23-5-,24-6+,25-7+,26-8+.
What are the key properties of N-[4,5,10-tris(ethylideneamino)phenanthren-1-yl]ethanimine?
N-[4,5,10-tris(ethylideneamino)phenanthren-1-yl]ethanimine has a molecular weight of 342.45 g/mol, XLogP of 6.88, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4,5,10-tris(ethylideneamino)phenanthren-1-yl]ethanimine is sourced from PubChem (CID 89212590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).