C10H17N3 — CID 89212599
2-cyclopenta-1,4-dien-1-yl-1,1,3,3-tetramethylguanidine (PubChem CID 89212599) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 2-cyclopenta-1,4-dien-1-yl-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-cyclopenta-1,4-dien-1-yl-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 89212599 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 2-cyclopenta-1,4-dien-1-yl-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=NC1=CCC=C1)N(C)C |
| InChI | InChI=1S/C10H17N3/c1-12(2)10(13(3)4)11-9-7-5-6-8-9/h5,7-8H,6H2,1-4H3 |
| InChIKey | AQIHTFGGARDYEJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|