C24H29NO3 — CID 89212649
ethyl 1-[4-amino-3-(cyclopropylmethoxy)-5-(4-methylphenyl)phenyl]cyclobutane-1-carboxylate (PubChem CID 89212649) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is ethyl 1-[4-amino-3-(cyclopropylmethoxy)-5-(4-methylphenyl)phenyl]cyclobutane-1-carboxylate.
| Compound Name | ethyl 1-[4-amino-3-(cyclopropylmethoxy)-5-(4-methylphenyl)phenyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 89212649 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | ethyl 1-[4-amino-3-(cyclopropylmethoxy)-5-(4-methylphenyl)phenyl]cyclobutane-1-carboxylate |
| SMILES | CCOC(=O)C1(c2cc(OCC3CC3)c(N)c(-c3ccc(C)cc3)c2)CCC1 |
| InChI | InChI=1S/C24H29NO3/c1-3-27-23(26)24(11-4-12-24)19-13-20(18-9-5-16(2)6-10-18)22(25)21(14-19)28-15-17-7-8-17/h5-6,9-10,13-14,17H,3-4,7-8,11-12,15,25H2,1-2H3 |
| InChIKey | YDKXHHMICCBXMB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|