C20H22F3NO5 — CID 89213297
ethyl 1-[(2S)-1-butoxypropan-2-yl]-6,7,8-trifluoro-2-formyl-4-oxoquinoline-3-carboxylate (PubChem CID 89213297) has the molecular formula C20H22F3NO5 and a molecular weight of 413.39 g/mol. Its IUPAC name is ethyl 1-[(2S)-1-butoxypropan-2-yl]-6,7,8-trifluoro-2-formyl-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 1-[(2S)-1-butoxypropan-2-yl]-6,7,8-trifluoro-2-formyl-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 89213297 |
| Molecular Formula | C20H22F3NO5 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | ethyl 1-[(2S)-1-butoxypropan-2-yl]-6,7,8-trifluoro-2-formyl-4-oxoquinoline-3-carboxylate |
| SMILES | CCCCOC[C@H](C)n1c(C=O)c(C(=O)OCC)c(=O)c2cc(F)c(F)c(F)c21 |
| InChI | InChI=1S/C20H22F3NO5/c1-4-6-7-28-10-11(3)24-14(9-25)15(20(27)29-5-2)19(26)12-8-13(21)16(22)17(23)18(12)24/h8-9,11H,4-7,10H2,1-3H3/t11-/m0/s1 |
| InChIKey | STJYZBXNLDFVKX-NSHDSACASA-N |
| XLogP | 3.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|