About N-[(1-methyl-3a,7a-dihydroindol-3-yl)methyl]methanimine
N-[(1-methyl-3a,7a-dihydroindol-3-yl)methyl]methanimine (PubChem CID 89213366) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is N-[(1-methyl-3a,7a-dihydroindol-3-yl)methyl]methanimine.
Molecular Properties
| Compound Name | N-[(1-methyl-3a,7a-dihydroindol-3-yl)methyl]methanimine |
| PubChem CID | 89213366 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | N-[(1-methyl-3a,7a-dihydroindol-3-yl)methyl]methanimine |
| SMILES | C=NCC1=CN(C)C2C=CC=CC12 |
| InChI | InChI=1S/C11H14N2/c1-12-7-9-8-13(2)11-6-4-3-5-10(9)11/h3-6,8,10-11H,1,7H2,2H3 |
| InChIKey | ICXVWDFIMTZQRT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(1-methyl-3a,7a-dihydroindol-3-yl)methyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-methyl-3a,7a-dihydroindol-3-yl)methyl]methanimine?
The IUPAC name of N-[(1-methyl-3a,7a-dihydroindol-3-yl)methyl]methanimine (CID 89213366) is N-[(1-methyl-3a,7a-dihydroindol-3-yl)methyl]methanimine.
What is the SMILES notation for N-[(1-methyl-3a,7a-dihydroindol-3-yl)methyl]methanimine?
The canonical SMILES for N-[(1-methyl-3a,7a-dihydroindol-3-yl)methyl]methanimine is C=NCC1=CN(C)C2C=CC=CC12.
What is the InChIKey of N-[(1-methyl-3a,7a-dihydroindol-3-yl)methyl]methanimine?
The InChIKey is ICXVWDFIMTZQRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-12-7-9-8-13(2)11-6-4-3-5-10(9)11/h3-6,8,10-11H,1,7H2,2H3.
What are the key properties of N-[(1-methyl-3a,7a-dihydroindol-3-yl)methyl]methanimine?
N-[(1-methyl-3a,7a-dihydroindol-3-yl)methyl]methanimine has a molecular weight of 174.25 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-methyl-3a,7a-dihydroindol-3-yl)methyl]methanimine is sourced from PubChem (CID 89213366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).