About O-cyclohexa-1,5-dien-1-yl N-(2-chloro-4-methylthiophen-3-yl)carbamothioate
O-cyclohexa-1,5-dien-1-yl N-(2-chloro-4-methylthiophen-3-yl)carbamothioate (PubChem CID 89214018) has the molecular formula C12H12ClNOS2
and a molecular weight of 285.82 g/mol. Its IUPAC name is O-cyclohexa-1,5-dien-1-yl N-(2-chloro-4-methylthiophen-3-yl)carbamothioate.
Molecular Properties
| Compound Name | O-cyclohexa-1,5-dien-1-yl N-(2-chloro-4-methylthiophen-3-yl)carbamothioate |
| PubChem CID | 89214018 |
| Molecular Formula | C12H12ClNOS2 |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | O-cyclohexa-1,5-dien-1-yl N-(2-chloro-4-methylthiophen-3-yl)carbamothioate |
| SMILES | Cc1csc(Cl)c1NC(=S)OC1=CCCC=C1 |
| InChI | InChI=1S/C12H12ClNOS2/c1-8-7-17-11(13)10(8)14-12(16)15-9-5-3-2-4-6-9/h3,5-7H,2,4H2,1H3,(H,14,16) |
| InChIKey | CIVAYRAAMKJSAQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-cyclohexa-1,5-dien-1-yl N-(2-chloro-4-methylthiophen-3-yl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-cyclohexa-1,5-dien-1-yl N-(2-chloro-4-methylthiophen-3-yl)carbamothioate?
The IUPAC name of O-cyclohexa-1,5-dien-1-yl N-(2-chloro-4-methylthiophen-3-yl)carbamothioate (CID 89214018) is O-cyclohexa-1,5-dien-1-yl N-(2-chloro-4-methylthiophen-3-yl)carbamothioate.
What is the SMILES notation for O-cyclohexa-1,5-dien-1-yl N-(2-chloro-4-methylthiophen-3-yl)carbamothioate?
The canonical SMILES for O-cyclohexa-1,5-dien-1-yl N-(2-chloro-4-methylthiophen-3-yl)carbamothioate is Cc1csc(Cl)c1NC(=S)OC1=CCCC=C1.
What is the InChIKey of O-cyclohexa-1,5-dien-1-yl N-(2-chloro-4-methylthiophen-3-yl)carbamothioate?
The InChIKey is CIVAYRAAMKJSAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClNOS2/c1-8-7-17-11(13)10(8)14-12(16)15-9-5-3-2-4-6-9/h3,5-7H,2,4H2,1H3,(H,14,16).
What are the key properties of O-cyclohexa-1,5-dien-1-yl N-(2-chloro-4-methylthiophen-3-yl)carbamothioate?
O-cyclohexa-1,5-dien-1-yl N-(2-chloro-4-methylthiophen-3-yl)carbamothioate has a molecular weight of 285.82 g/mol, XLogP of 4.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-cyclohexa-1,5-dien-1-yl N-(2-chloro-4-methylthiophen-3-yl)carbamothioate is sourced from PubChem (CID 89214018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).