C15H19F13O2 — CID 89214033
4,4,5,5,7,7,8-heptafluoro-8-(1,1,2,3,3,3-hexafluoropropoxy)-3,3,6,6-tetramethyloctan-2-ol (PubChem CID 89214033) has the molecular formula C15H19F13O2 and a molecular weight of 478.29 g/mol. Its IUPAC name is 4,4,5,5,7,7,8-heptafluoro-8-(1,1,2,3,3,3-hexafluoropropoxy)-3,3,6,6-tetramethyloctan-2-ol.
| Compound Name | 4,4,5,5,7,7,8-heptafluoro-8-(1,1,2,3,3,3-hexafluoropropoxy)-3,3,6,6-tetramethyloctan-2-ol |
|---|---|
| PubChem CID | 89214033 |
| Molecular Formula | C15H19F13O2 |
| Molecular Weight | 478.29 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 4,4,5,5,7,7,8-heptafluoro-8-(1,1,2,3,3,3-hexafluoropropoxy)-3,3,6,6-tetramethyloctan-2-ol |
| SMILES | CC(O)C(C)(C)C(F)(F)C(F)(F)C(C)(C)C(F)(F)C(F)OC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C15H19F13O2/c1-6(29)9(2,3)14(25,26)15(27,28)10(4,5)11(18,19)8(17)30-13(23,24)7(16)12(20,21)22/h6-8,29H,1-5H3 |
| InChIKey | FSYLGHVLVAITHI-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.29 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|