C21H23NO4S — CID 8921422
2-(3,5-dimethylphenoxy)ethyl 3-(3-oxo-1,4-benzothiazin-4-yl)propanoate (PubChem CID 8921422) has the molecular formula C21H23NO4S and a molecular weight of 385.49 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)ethyl 3-(3-oxo-1,4-benzothiazin-4-yl)propanoate.
| Compound Name | 2-(3,5-dimethylphenoxy)ethyl 3-(3-oxo-1,4-benzothiazin-4-yl)propanoate |
|---|---|
| PubChem CID | 8921422 |
| Molecular Formula | C21H23NO4S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)ethyl 3-(3-oxo-1,4-benzothiazin-4-yl)propanoate |
| SMILES | Cc1cc(C)cc(OCCOC(=O)CCN2C(=O)CSc3ccccc32)c1 |
| InChI | InChI=1S/C21H23NO4S/c1-15-11-16(2)13-17(12-15)25-9-10-26-21(24)7-8-22-18-5-3-4-6-19(18)27-14-20(22)23/h3-6,11-13H,7-10,14H2,1-2H3 |
| InChIKey | PYZXZDLHGCYLRN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|