C30H48NO2P — CID 89214527
2-[2-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]hexan-2-ylphosphanyl]-N,N-dimethylaniline (PubChem CID 89214527) has the molecular formula C30H48NO2P and a molecular weight of 485.69 g/mol. Its IUPAC name is 2-[2-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]hexan-2-ylphosphanyl]-N,N-dimethylaniline.
| Compound Name | 2-[2-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]hexan-2-ylphosphanyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 89214527 |
| Molecular Formula | C30H48NO2P |
| Molecular Weight | 485.69 g/mol |
| Exact Mass | 485.34 |
| IUPAC Name | 2-[2-[3,5-ditert-butyl-2-(methoxymethoxy)phenyl]hexan-2-ylphosphanyl]-N,N-dimethylaniline |
| SMILES | CCCCC(C)(Pc1ccccc1N(C)C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1OCOC |
| InChI | InChI=1S/C30H48NO2P/c1-12-13-18-30(8,34-26-17-15-14-16-25(26)31(9)10)24-20-22(28(2,3)4)19-23(29(5,6)7)27(24)33-21-32-11/h14-17,19-20,34H,12-13,18,21H2,1-11H3 |
| InChIKey | MKULOAHAOVEKRL-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.69 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|