About 4-[(Z)-prop-1-enyl]-1,3-benzodioxole
4-[(Z)-prop-1-enyl]-1,3-benzodioxole (PubChem CID 89214713) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is 4-[(Z)-prop-1-enyl]-1,3-benzodioxole.
Molecular Properties
| Compound Name | 4-[(Z)-prop-1-enyl]-1,3-benzodioxole |
| PubChem CID | 89214713 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | 4-[(Z)-prop-1-enyl]-1,3-benzodioxole |
| SMILES | C/C=C\c1cccc2c1OCO2 |
| InChI | InChI=1S/C10H10O2/c1-2-4-8-5-3-6-9-10(8)12-7-11-9/h2-6H,7H2,1H3/b4-2- |
| InChIKey | BLTZBNMFKAUMRR-RQOWECAXSA-N |
| XLogP | 2.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(Z)-prop-1-enyl]-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-prop-1-enyl]-1,3-benzodioxole?
The IUPAC name of 4-[(Z)-prop-1-enyl]-1,3-benzodioxole (CID 89214713) is 4-[(Z)-prop-1-enyl]-1,3-benzodioxole.
What is the SMILES notation for 4-[(Z)-prop-1-enyl]-1,3-benzodioxole?
The canonical SMILES for 4-[(Z)-prop-1-enyl]-1,3-benzodioxole is C/C=C\c1cccc2c1OCO2.
What is the InChIKey of 4-[(Z)-prop-1-enyl]-1,3-benzodioxole?
The InChIKey is BLTZBNMFKAUMRR-RQOWECAXSA-N. The full InChI is InChI=1S/C10H10O2/c1-2-4-8-5-3-6-9-10(8)12-7-11-9/h2-6H,7H2,1H3/b4-2-.
What are the key properties of 4-[(Z)-prop-1-enyl]-1,3-benzodioxole?
4-[(Z)-prop-1-enyl]-1,3-benzodioxole has a molecular weight of 162.19 g/mol, XLogP of 2.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-prop-1-enyl]-1,3-benzodioxole is sourced from PubChem (CID 89214713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).