C18H30N2O5S — CID 89214735
5-(tert-butylsulfonylamino)-N-(3,4-dihydroxy-2,5-dimethylphenyl)-3-methylpentanamide (PubChem CID 89214735) has the molecular formula C18H30N2O5S and a molecular weight of 386.51 g/mol. Its IUPAC name is 5-(tert-butylsulfonylamino)-N-(3,4-dihydroxy-2,5-dimethylphenyl)-3-methylpentanamide.
| Compound Name | 5-(tert-butylsulfonylamino)-N-(3,4-dihydroxy-2,5-dimethylphenyl)-3-methylpentanamide |
|---|---|
| PubChem CID | 89214735 |
| Molecular Formula | C18H30N2O5S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 5-(tert-butylsulfonylamino)-N-(3,4-dihydroxy-2,5-dimethylphenyl)-3-methylpentanamide |
| SMILES | Cc1cc(NC(=O)CC(C)CCNS(=O)(=O)C(C)(C)C)c(C)c(O)c1O |
| InChI | InChI=1S/C18H30N2O5S/c1-11(7-8-19-26(24,25)18(4,5)6)9-15(21)20-14-10-12(2)16(22)17(23)13(14)3/h10-11,19,22-23H,7-9H2,1-6H3,(H,20,21) |
| InChIKey | XVMNOWRDYQXZIF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|