C14H23F3N2O — CID 89214736
5-amino-N-[(2R,3Z,5E)-3-methyl-5-(trifluoromethyl)hepta-3,5-dien-2-yl]pentanamide (PubChem CID 89214736) has the molecular formula C14H23F3N2O and a molecular weight of 292.34 g/mol. Its IUPAC name is 5-amino-N-[(2R,3Z,5E)-3-methyl-5-(trifluoromethyl)hepta-3,5-dien-2-yl]pentanamide.
| Compound Name | 5-amino-N-[(2R,3Z,5E)-3-methyl-5-(trifluoromethyl)hepta-3,5-dien-2-yl]pentanamide |
|---|---|
| PubChem CID | 89214736 |
| Molecular Formula | C14H23F3N2O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 5-amino-N-[(2R,3Z,5E)-3-methyl-5-(trifluoromethyl)hepta-3,5-dien-2-yl]pentanamide |
| SMILES | C/C=C(\C=C(\C)[C@@H](C)NC(=O)CCCCN)C(F)(F)F |
| InChI | InChI=1S/C14H23F3N2O/c1-4-12(14(15,16)17)9-10(2)11(3)19-13(20)7-5-6-8-18/h4,9,11H,5-8,18H2,1-3H3,(H,19,20)/b10-9-,12-4+/t11-/m1/s1 |
| InChIKey | NLQWCDHYCCCYSC-PBQJHGEMSA-N |
| XLogP | 3.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|