C7H8F3N — CID 89214739
(3Z,5E)-2,4,6-trifluorohepta-1,3,5-trien-3-amine (PubChem CID 89214739) has the molecular formula C7H8F3N and a molecular weight of 163.14 g/mol. Its IUPAC name is (3Z,5E)-2,4,6-trifluorohepta-1,3,5-trien-3-amine.
| Compound Name | (3Z,5E)-2,4,6-trifluorohepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 89214739 |
| Molecular Formula | C7H8F3N |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | (3Z,5E)-2,4,6-trifluorohepta-1,3,5-trien-3-amine |
| SMILES | C=C(F)/C(N)=C(F)\C=C(/C)F |
| InChI | InChI=1S/C7H8F3N/c1-4(8)3-6(10)7(11)5(2)9/h3H,2,11H2,1H3/b4-3+,7-6- |
| InChIKey | WPQWTBAYXUROAR-FDTUMDBZSA-N |
| XLogP | 2.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|