About N-[(5Z)-7-fluorohepta-1,5-dien-3-yl]formamide
N-[(5Z)-7-fluorohepta-1,5-dien-3-yl]formamide (PubChem CID 89214742) has the molecular formula C8H12FNO
and a molecular weight of 157.19 g/mol. Its IUPAC name is N-[(5Z)-7-fluorohepta-1,5-dien-3-yl]formamide.
Molecular Properties
| Compound Name | N-[(5Z)-7-fluorohepta-1,5-dien-3-yl]formamide |
| PubChem CID | 89214742 |
| Molecular Formula | C8H12FNO |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | N-[(5Z)-7-fluorohepta-1,5-dien-3-yl]formamide |
| SMILES | C=CC(C/C=C\CF)NC=O |
| InChI | InChI=1S/C8H12FNO/c1-2-8(10-7-11)5-3-4-6-9/h2-4,7-8H,1,5-6H2,(H,10,11)/b4-3- |
| InChIKey | RGGRQSDMAQMNPS-ARJAWSKDSA-N |
| XLogP | 1.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(5Z)-7-fluorohepta-1,5-dien-3-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5Z)-7-fluorohepta-1,5-dien-3-yl]formamide?
The IUPAC name of N-[(5Z)-7-fluorohepta-1,5-dien-3-yl]formamide (CID 89214742) is N-[(5Z)-7-fluorohepta-1,5-dien-3-yl]formamide.
What is the SMILES notation for N-[(5Z)-7-fluorohepta-1,5-dien-3-yl]formamide?
The canonical SMILES for N-[(5Z)-7-fluorohepta-1,5-dien-3-yl]formamide is C=CC(C/C=C\CF)NC=O.
What is the InChIKey of N-[(5Z)-7-fluorohepta-1,5-dien-3-yl]formamide?
The InChIKey is RGGRQSDMAQMNPS-ARJAWSKDSA-N. The full InChI is InChI=1S/C8H12FNO/c1-2-8(10-7-11)5-3-4-6-9/h2-4,7-8H,1,5-6H2,(H,10,11)/b4-3-.
What are the key properties of N-[(5Z)-7-fluorohepta-1,5-dien-3-yl]formamide?
N-[(5Z)-7-fluorohepta-1,5-dien-3-yl]formamide has a molecular weight of 157.19 g/mol, XLogP of 1.20, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5Z)-7-fluorohepta-1,5-dien-3-yl]formamide is sourced from PubChem (CID 89214742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).