C12H20F2N2O — CID 89214760
N-[(2Z,4E)-4,6-difluorohexa-2,4-dienyl]-5-(methylamino)pentanamide (PubChem CID 89214760) has the molecular formula C12H20F2N2O and a molecular weight of 246.30 g/mol. Its IUPAC name is N-[(2Z,4E)-4,6-difluorohexa-2,4-dienyl]-5-(methylamino)pentanamide.
| Compound Name | N-[(2Z,4E)-4,6-difluorohexa-2,4-dienyl]-5-(methylamino)pentanamide |
|---|---|
| PubChem CID | 89214760 |
| Molecular Formula | C12H20F2N2O |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | N-[(2Z,4E)-4,6-difluorohexa-2,4-dienyl]-5-(methylamino)pentanamide |
| SMILES | CNCCCCC(=O)NC/C=C\C(F)=C/CF |
| InChI | InChI=1S/C12H20F2N2O/c1-15-9-3-2-6-12(17)16-10-4-5-11(14)7-8-13/h4-5,7,15H,2-3,6,8-10H2,1H3,(H,16,17)/b5-4-,11-7+ |
| InChIKey | LNPZHZPXBRCDBU-DNFZQOLXSA-N |
| XLogP | 1.87 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|