C12H14N2O2 — CID 89214762
N-[(3E,5E)-6-(5-methyl-1,3-oxazol-2-yl)hepta-1,3,5-trien-3-yl]formamide (PubChem CID 89214762) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is N-[(3E,5E)-6-(5-methyl-1,3-oxazol-2-yl)hepta-1,3,5-trien-3-yl]formamide.
| Compound Name | N-[(3E,5E)-6-(5-methyl-1,3-oxazol-2-yl)hepta-1,3,5-trien-3-yl]formamide |
|---|---|
| PubChem CID | 89214762 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N-[(3E,5E)-6-(5-methyl-1,3-oxazol-2-yl)hepta-1,3,5-trien-3-yl]formamide |
| SMILES | C=C/C(=C\C=C(/C)c1ncc(C)o1)NC=O |
| InChI | InChI=1S/C12H14N2O2/c1-4-11(14-8-15)6-5-9(2)12-13-7-10(3)16-12/h4-8H,1H2,2-3H3,(H,14,15)/b9-5+,11-6+ |
| InChIKey | ZYTLTHDPMHZYAP-MPEOSAONSA-N |
| XLogP | 2.20 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|