C21H30FN3O2 — CID 89214775
(2E)-2-[(Z)-3-aminoprop-1-enyl]-N-[(2E,4E)-4-(2,6-dimethylmorpholin-4-yl)-2-fluorohepta-2,4,6-trienyl]penta-2,4-dienamide (PubChem CID 89214775) has the molecular formula C21H30FN3O2 and a molecular weight of 375.49 g/mol. Its IUPAC name is (2E)-2-[(Z)-3-aminoprop-1-enyl]-N-[(2E,4E)-4-(2,6-dimethylmorpholin-4-yl)-2-fluorohepta-2,4,6-trienyl]penta-2,4-dienamide.
| Compound Name | (2E)-2-[(Z)-3-aminoprop-1-enyl]-N-[(2E,4E)-4-(2,6-dimethylmorpholin-4-yl)-2-fluorohepta-2,4,6-trienyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 89214775 |
| Molecular Formula | C21H30FN3O2 |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (2E)-2-[(Z)-3-aminoprop-1-enyl]-N-[(2E,4E)-4-(2,6-dimethylmorpholin-4-yl)-2-fluorohepta-2,4,6-trienyl]penta-2,4-dienamide |
| SMILES | C=C/C=C(\C=C/CN)C(=O)NC/C(F)=C\C(=C/C=C)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C21H30FN3O2/c1-5-8-18(10-7-11-23)21(26)24-13-19(22)12-20(9-6-2)25-14-16(3)27-17(4)15-25/h5-10,12,16-17H,1-2,11,13-15,23H2,3-4H3,(H,24,26)/b10-7-,18-8+,19-12+,20-9+ |
| InChIKey | CEOWHZGQZGIOKG-LFSDSZJGSA-N |
| XLogP | 2.76 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|