C13H20F2N2O — CID 89214778
(3E,5Z)-5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4,6-difluorohepta-1,3,5-trien-2-amine (PubChem CID 89214778) has the molecular formula C13H20F2N2O and a molecular weight of 258.31 g/mol. Its IUPAC name is (3E,5Z)-5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4,6-difluorohepta-1,3,5-trien-2-amine.
| Compound Name | (3E,5Z)-5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4,6-difluorohepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 89214778 |
| Molecular Formula | C13H20F2N2O |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (3E,5Z)-5-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4,6-difluorohepta-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C=C(F)\C(=C(/C)F)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C13H20F2N2O/c1-8(16)5-12(15)13(11(4)14)17-6-9(2)18-10(3)7-17/h5,9-10H,1,6-7,16H2,2-4H3/b12-5+,13-11-/t9-,10+ |
| InChIKey | URDZQSWQGAKXPO-RTZKUOHDSA-N |
| XLogP | 2.62 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|