C15H17F5N2O — CID 89214781
(4R)-4-amino-N-[(2E,4Z)-3,5-difluoro-4-(trifluoromethyl)hepta-2,4,6-trienyl]cyclohex-2-ene-1-carboxamide (PubChem CID 89214781) has the molecular formula C15H17F5N2O and a molecular weight of 336.30 g/mol. Its IUPAC name is (4R)-4-amino-N-[(2E,4Z)-3,5-difluoro-4-(trifluoromethyl)hepta-2,4,6-trienyl]cyclohex-2-ene-1-carboxamide.
| Compound Name | (4R)-4-amino-N-[(2E,4Z)-3,5-difluoro-4-(trifluoromethyl)hepta-2,4,6-trienyl]cyclohex-2-ene-1-carboxamide |
|---|---|
| PubChem CID | 89214781 |
| Molecular Formula | C15H17F5N2O |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (4R)-4-amino-N-[(2E,4Z)-3,5-difluoro-4-(trifluoromethyl)hepta-2,4,6-trienyl]cyclohex-2-ene-1-carboxamide |
| SMILES | C=C/C(F)=C(C(\F)=C/CNC(=O)C1C=C[C@H](N)CC1)/C(F)(F)F |
| InChI | InChI=1S/C15H17F5N2O/c1-2-11(16)13(15(18,19)20)12(17)7-8-22-14(23)9-3-5-10(21)6-4-9/h2-3,5,7,9-10H,1,4,6,8,21H2,(H,22,23)/b12-7+,13-11-/t9?,10-/m0/s1 |
| InChIKey | NYTSOCHWLRQIRG-IUVQLVMDSA-N |
| XLogP | 3.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|