C20H30FN3O2 — CID 89214782
(Z,2E)-5-amino-2-ethylidene-N-[(3Z,5E)-5-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,3,5-trien-2-yl]pent-3-enamide (PubChem CID 89214782) has the molecular formula C20H30FN3O2 and a molecular weight of 363.48 g/mol. Its IUPAC name is (Z,2E)-5-amino-2-ethylidene-N-[(3Z,5E)-5-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,3,5-trien-2-yl]pent-3-enamide.
| Compound Name | (Z,2E)-5-amino-2-ethylidene-N-[(3Z,5E)-5-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,3,5-trien-2-yl]pent-3-enamide |
|---|---|
| PubChem CID | 89214782 |
| Molecular Formula | C20H30FN3O2 |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | (Z,2E)-5-amino-2-ethylidene-N-[(3Z,5E)-5-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,3,5-trien-2-yl]pent-3-enamide |
| SMILES | C=C(/C=C\C(=C/C)N1CC(C)OC(C)C1F)NC(=O)C(/C=C\CN)=C/C |
| InChI | InChI=1S/C20H30FN3O2/c1-6-17(9-8-12-22)20(25)23-14(3)10-11-18(7-2)24-13-15(4)26-16(5)19(24)21/h6-11,15-16,19H,3,12-13,22H2,1-2,4-5H3,(H,23,25)/b9-8-,11-10-,17-6+,18-7+ |
| InChIKey | ZGTISHXWYRHXJX-GSQQQJKGSA-N |
| XLogP | 2.94 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|