About (5Z)-7-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,5-dien-4-amine
(5Z)-7-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,5-dien-4-amine (PubChem CID 89214787) has the molecular formula C13H23FN2O
and a molecular weight of 242.34 g/mol. Its IUPAC name is (5Z)-7-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,5-dien-4-amine.
Molecular Properties
| Compound Name | (5Z)-7-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,5-dien-4-amine |
| PubChem CID | 89214787 |
| Molecular Formula | C13H23FN2O |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | (5Z)-7-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,5-dien-4-amine |
| SMILES | C=CCC(N)/C=C\CN1CC(C)OC(C)C1F |
| InChI | InChI=1S/C13H23FN2O/c1-4-6-12(15)7-5-8-16-9-10(2)17-11(3)13(16)14/h4-5,7,10-13H,1,6,8-9,15H2,2-3H3/b7-5- |
| InChIKey | OZUFSLVQKPFURU-ALCCZGGFSA-N |
| XLogP | 1.85 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-7-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,5-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-7-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,5-dien-4-amine?
The IUPAC name of (5Z)-7-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,5-dien-4-amine (CID 89214787) is (5Z)-7-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,5-dien-4-amine.
What is the SMILES notation for (5Z)-7-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,5-dien-4-amine?
The canonical SMILES for (5Z)-7-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,5-dien-4-amine is C=CCC(N)/C=C\CN1CC(C)OC(C)C1F.
What is the InChIKey of (5Z)-7-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,5-dien-4-amine?
The InChIKey is OZUFSLVQKPFURU-ALCCZGGFSA-N. The full InChI is InChI=1S/C13H23FN2O/c1-4-6-12(15)7-5-8-16-9-10(2)17-11(3)13(16)14/h4-5,7,10-13H,1,6,8-9,15H2,2-3H3/b7-5-.
What are the key properties of (5Z)-7-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,5-dien-4-amine?
(5Z)-7-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,5-dien-4-amine has a molecular weight of 242.34 g/mol, XLogP of 1.85, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-7-(3-fluoro-2,6-dimethylmorpholin-4-yl)hepta-1,5-dien-4-amine is sourced from PubChem (CID 89214787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).