C13H23N3O2 — CID 89214851
N-[(5E)-6-amino-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hexa-1,5-dien-3-yl]formamide (PubChem CID 89214851) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is N-[(5E)-6-amino-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hexa-1,5-dien-3-yl]formamide.
| Compound Name | N-[(5E)-6-amino-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hexa-1,5-dien-3-yl]formamide |
|---|---|
| PubChem CID | 89214851 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N-[(5E)-6-amino-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]hexa-1,5-dien-3-yl]formamide |
| SMILES | C=CC(C/C=C(\N)N1C[C@@H](C)O[C@@H](C)C1)NC=O |
| InChI | InChI=1S/C13H23N3O2/c1-4-12(15-9-17)5-6-13(14)16-7-10(2)18-11(3)8-16/h4,6,9-12H,1,5,7-8,14H2,2-3H3,(H,15,17)/b13-6+/t10-,11+,12? |
| InChIKey | OSQBEWRLGQPQEM-IVTDPIIGSA-N |
| XLogP | 0.59 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|