C15H25F3N2O — CID 89214853
5-(methylamino)-N-[(2E,4Z)-7,7,7-trifluoro-4,6-dimethylhepta-2,4-dien-3-yl]pentanamide (PubChem CID 89214853) has the molecular formula C15H25F3N2O and a molecular weight of 306.37 g/mol. Its IUPAC name is 5-(methylamino)-N-[(2E,4Z)-7,7,7-trifluoro-4,6-dimethylhepta-2,4-dien-3-yl]pentanamide.
| Compound Name | 5-(methylamino)-N-[(2E,4Z)-7,7,7-trifluoro-4,6-dimethylhepta-2,4-dien-3-yl]pentanamide |
|---|---|
| PubChem CID | 89214853 |
| Molecular Formula | C15H25F3N2O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 5-(methylamino)-N-[(2E,4Z)-7,7,7-trifluoro-4,6-dimethylhepta-2,4-dien-3-yl]pentanamide |
| SMILES | C/C=C(NC(=O)CCCCNC)\C(C)=C/C(C)C(F)(F)F |
| InChI | InChI=1S/C15H25F3N2O/c1-5-13(11(2)10-12(3)15(16,17)18)20-14(21)8-6-7-9-19-4/h5,10,12,19H,6-9H2,1-4H3,(H,20,21)/b11-10-,13-5+ |
| InChIKey | UNMDIWDUBWQAFV-RUOUNYFASA-N |
| XLogP | 3.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|