C17H28N2O2 — CID 89214883
(3Z,5E)-6-(propanoylamino)-N,N-di(propan-2-yl)octa-3,5,7-trienamide (PubChem CID 89214883) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is (3Z,5E)-6-(propanoylamino)-N,N-di(propan-2-yl)octa-3,5,7-trienamide.
| Compound Name | (3Z,5E)-6-(propanoylamino)-N,N-di(propan-2-yl)octa-3,5,7-trienamide |
|---|---|
| PubChem CID | 89214883 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (3Z,5E)-6-(propanoylamino)-N,N-di(propan-2-yl)octa-3,5,7-trienamide |
| SMILES | C=C/C(=C\C=C/CC(=O)N(C(C)C)C(C)C)NC(=O)CC |
| InChI | InChI=1S/C17H28N2O2/c1-7-15(18-16(20)8-2)11-9-10-12-17(21)19(13(3)4)14(5)6/h7,9-11,13-14H,1,8,12H2,2-6H3,(H,18,20)/b10-9-,15-11+ |
| InChIKey | KRQJRWJORNOXDN-JCCAHGDBSA-N |
| XLogP | 3.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|