About 4-fluoro-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine
4-fluoro-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine (PubChem CID 89214936) has the molecular formula C7H7F4NO
and a molecular weight of 197.13 g/mol. Its IUPAC name is 4-fluoro-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 4-fluoro-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine |
| PubChem CID | 89214936 |
| Molecular Formula | C7H7F4NO |
| Molecular Weight | 197.13 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 4-fluoro-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine |
| SMILES | NC1=CCC(F)C(OC(F)(F)F)=C1 |
| InChI | InChI=1S/C7H7F4NO/c8-5-2-1-4(12)3-6(5)13-7(9,10)11/h1,3,5H,2,12H2 |
| InChIKey | OYIBCSRNVNMSGI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.13 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine?
The IUPAC name of 4-fluoro-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine (CID 89214936) is 4-fluoro-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 4-fluoro-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine?
The canonical SMILES for 4-fluoro-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine is NC1=CCC(F)C(OC(F)(F)F)=C1.
What is the InChIKey of 4-fluoro-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine?
The InChIKey is OYIBCSRNVNMSGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F4NO/c8-5-2-1-4(12)3-6(5)13-7(9,10)11/h1,3,5H,2,12H2.
What are the key properties of 4-fluoro-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine?
4-fluoro-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine has a molecular weight of 197.13 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-5-(trifluoromethoxy)cyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 89214936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).