C14H16F2N2O — CID 89214940
4-amino-N-[(3Z,5Z)-2,4-difluorohepta-1,3,5-trien-3-yl]cyclohexa-1,3-diene-1-carboxamide (PubChem CID 89214940) has the molecular formula C14H16F2N2O and a molecular weight of 266.29 g/mol. Its IUPAC name is 4-amino-N-[(3Z,5Z)-2,4-difluorohepta-1,3,5-trien-3-yl]cyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 4-amino-N-[(3Z,5Z)-2,4-difluorohepta-1,3,5-trien-3-yl]cyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 89214940 |
| Molecular Formula | C14H16F2N2O |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 4-amino-N-[(3Z,5Z)-2,4-difluorohepta-1,3,5-trien-3-yl]cyclohexa-1,3-diene-1-carboxamide |
| SMILES | C=C(F)/C(NC(=O)C1=CC=C(N)CC1)=C(F)\C=C/C |
| InChI | InChI=1S/C14H16F2N2O/c1-3-4-12(16)13(9(2)15)18-14(19)10-5-7-11(17)8-6-10/h3-5,7H,2,6,8,17H2,1H3,(H,18,19)/b4-3-,13-12- |
| InChIKey | HGHUCRULAQIUNU-RTWPIBFVSA-N |
| XLogP | 2.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|